C20H31Cl2NO3 — CID 154381705
N-[(4-butoxyphenyl)methyl]-N-(3-butoxypropyl)-2,2-dichloroacetamide (PubChem CID 154381705) has the molecular formula C20H31Cl2NO3 and a molecular weight of 404.38 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-N-(3-butoxypropyl)-2,2-dichloroacetamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-N-(3-butoxypropyl)-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 154381705 |
| Molecular Formula | C20H31Cl2NO3 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-N-(3-butoxypropyl)-2,2-dichloroacetamide |
| SMILES | CCCCOCCCN(Cc1ccc(OCCCC)cc1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C20H31Cl2NO3/c1-3-5-13-25-14-7-12-23(20(24)19(21)22)16-17-8-10-18(11-9-17)26-15-6-4-2/h8-11,19H,3-7,12-16H2,1-2H3 |
| InChIKey | WVNMYBKKDGZXJX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|