About N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide
N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide (PubChem CID 42709041) has the molecular formula C26H27Cl2NO
and a molecular weight of 440.41 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide.
Molecular Properties
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide |
| PubChem CID | 42709041 |
| Molecular Formula | C26H27Cl2NO |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide |
| SMILES | CCC(C(=O)N(CCc1ccc(Cl)cc1Cl)Cc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27Cl2NO/c1-3-24(21-7-5-4-6-8-21)26(30)29(18-20-11-9-19(2)10-12-20)16-15-22-13-14-23(27)17-25(22)28/h4-14,17,24H,3,15-16,18H2,1-2H3 |
| InChIKey | RJJSIBJZVXELAX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide?
The IUPAC name of N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide (CID 42709041) is N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide.
What is the SMILES notation for N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide?
The canonical SMILES for N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide is CCC(C(=O)N(CCc1ccc(Cl)cc1Cl)Cc1ccc(C)cc1)c1ccccc1.
What is the InChIKey of N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide?
The InChIKey is RJJSIBJZVXELAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27Cl2NO/c1-3-24(21-7-5-4-6-8-21)26(30)29(18-20-11-9-19(2)10-12-20)16-15-22-13-14-23(27)17-25(22)28/h4-14,17,24H,3,15-16,18H2,1-2H3.
What are the key properties of N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide?
N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide has a molecular weight of 440.41 g/mol, XLogP of 7.07, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,4-dichlorophenyl)ethyl]-N-[(4-methylphenyl)methyl]-2-phenylbutanamide is sourced from PubChem (CID 42709041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).