C31H24Cl2N2O3 — CID 42697551
N-(anthracen-9-ylmethyl)-N-[2-(2,4-dichlorophenyl)ethyl]-4-methyl-3-nitrobenzamide (PubChem CID 42697551) has the molecular formula C31H24Cl2N2O3 and a molecular weight of 543.45 g/mol. Its IUPAC name is N-(anthracen-9-ylmethyl)-N-[2-(2,4-dichlorophenyl)ethyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-(anthracen-9-ylmethyl)-N-[2-(2,4-dichlorophenyl)ethyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42697551 |
| Molecular Formula | C31H24Cl2N2O3 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | N-(anthracen-9-ylmethyl)-N-[2-(2,4-dichlorophenyl)ethyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)N(CCc2ccc(Cl)cc2Cl)Cc2c3ccccc3cc3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H24Cl2N2O3/c1-20-10-11-24(17-30(20)35(37)38)31(36)34(15-14-21-12-13-25(32)18-29(21)33)19-28-26-8-4-2-6-22(26)16-23-7-3-5-9-27(23)28/h2-13,16-18H,14-15,19H2,1H3 |
| InChIKey | FGFRDNQDSRNOCS-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|