C21H24Cl2FNO — CID 42709412
N-[2-(2,4-dichlorophenyl)ethyl]-N-[(2-fluorophenyl)methyl]hexanamide (PubChem CID 42709412) has the molecular formula C21H24Cl2FNO and a molecular weight of 396.33 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-N-[(2-fluorophenyl)methyl]hexanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-N-[(2-fluorophenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 42709412 |
| Molecular Formula | C21H24Cl2FNO |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-N-[(2-fluorophenyl)methyl]hexanamide |
| SMILES | CCCCCC(=O)N(CCc1ccc(Cl)cc1Cl)Cc1ccccc1F |
| InChI | InChI=1S/C21H24Cl2FNO/c1-2-3-4-9-21(26)25(15-17-7-5-6-8-20(17)24)13-12-16-10-11-18(22)14-19(16)23/h5-8,10-11,14H,2-4,9,12-13,15H2,1H3 |
| InChIKey | GJVLSRLHXYFJRQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|