C10H16N2O2S — CID 106925753
N-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]oxan-4-amine (PubChem CID 106925753) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is N-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]oxan-4-amine.
| Compound Name | N-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]oxan-4-amine |
|---|---|
| PubChem CID | 106925753 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-[2-(1,3-oxazol-2-ylsulfanyl)ethyl]oxan-4-amine |
| SMILES | c1coc(SCCNC2CCOCC2)n1 |
| InChI | InChI=1S/C10H16N2O2S/c1-5-13-6-2-9(1)11-4-8-15-10-12-3-7-14-10/h3,7,9,11H,1-2,4-6,8H2 |
| InChIKey | PKRAVTFYDSSTQT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|