C11H17N3S — CID 62576130
N-(2-pyrimidin-2-ylsulfanylethyl)cyclopentanamine (PubChem CID 62576130) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is N-(2-pyrimidin-2-ylsulfanylethyl)cyclopentanamine.
| Compound Name | N-(2-pyrimidin-2-ylsulfanylethyl)cyclopentanamine |
|---|---|
| PubChem CID | 62576130 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-(2-pyrimidin-2-ylsulfanylethyl)cyclopentanamine |
| SMILES | c1cnc(SCCNC2CCCC2)nc1 |
| InChI | InChI=1S/C11H17N3S/c1-2-5-10(4-1)12-8-9-15-11-13-6-3-7-14-11/h3,6-7,10,12H,1-2,4-5,8-9H2 |
| InChIKey | VSRGSSCZUYRKQH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|