C14H21NO4S2 — CID 63237752
2-amino-2-methyl-6-(4-methylsulfonylphenyl)sulfanylhexanoic acid (PubChem CID 63237752) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-amino-2-methyl-6-(4-methylsulfonylphenyl)sulfanylhexanoic acid.
| Compound Name | 2-amino-2-methyl-6-(4-methylsulfonylphenyl)sulfanylhexanoic acid |
|---|---|
| PubChem CID | 63237752 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-amino-2-methyl-6-(4-methylsulfonylphenyl)sulfanylhexanoic acid |
| SMILES | CC(N)(CCCCSc1ccc(S(C)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C14H21NO4S2/c1-14(15,13(16)17)9-3-4-10-20-11-5-7-12(8-6-11)21(2,18)19/h5-8H,3-4,9-10,15H2,1-2H3,(H,16,17) |
| InChIKey | YSSFHNJNVRVSOP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|