3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid

C13H18O3S — CID 116853029

IUPAC3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid
SMILESCCOc1ccc(SCC(C)(C)C(=O)O)cc1
InChIInChI=1S/C13H18O3S/c1-4-16-10-5-7-11(8-6-10)17-9-13(2,3)12(14)15/h5-8H,4,9H2,1-3H3,(H,14,15)
InChIKeyLPEJSIGTXQSWKV-UHFFFAOYSA-N
MW254.35 g/mol
LogP3.29
Rot. Bonds6

About 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid

3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid (PubChem CID 116853029) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid
PubChem CID116853029
Molecular FormulaC13H18O3S
Molecular Weight254.35 g/mol
Exact Mass254.10
IUPAC Name3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid
SMILESCCOc1ccc(SCC(C)(C)C(=O)O)cc1
InChIInChI=1S/C13H18O3S/c1-4-16-10-5-7-11(8-6-10)17-9-13(2,3)12(14)15/h5-8H,4,9H2,1-3H3,(H,14,15)
InChIKeyLPEJSIGTXQSWKV-UHFFFAOYSA-N
XLogP3.29
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.35
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid (CID 116853029) is 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid is CCOc1ccc(SCC(C)(C)C(=O)O)cc1.
What is the InChIKey of 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid?
The InChIKey is LPEJSIGTXQSWKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3S/c1-4-16-10-5-7-11(8-6-10)17-9-13(2,3)12(14)15/h5-8H,4,9H2,1-3H3,(H,14,15).
What are the key properties of 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid?
3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid has a molecular weight of 254.35 g/mol, XLogP of 3.29, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethoxyphenyl)sulfanyl-2,2-dimethylpropanoic acid is sourced from PubChem (CID 116853029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).