C14H21NO2S — CID 86912273
2-(4-ethoxyphenyl)sulfanyl-N-methyl-N-propan-2-ylacetamide (PubChem CID 86912273) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)sulfanyl-N-methyl-N-propan-2-ylacetamide.
| Compound Name | 2-(4-ethoxyphenyl)sulfanyl-N-methyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 86912273 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-(4-ethoxyphenyl)sulfanyl-N-methyl-N-propan-2-ylacetamide |
| SMILES | CCOc1ccc(SCC(=O)N(C)C(C)C)cc1 |
| InChI | InChI=1S/C14H21NO2S/c1-5-17-12-6-8-13(9-7-12)18-10-14(16)15(4)11(2)3/h6-9,11H,5,10H2,1-4H3 |
| InChIKey | RXDABISAIDUMHE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |