C21H24N2O6 — CID 67712356
2-amino-N-[2-(4-hydroxyphenyl)-1-phenylpropan-2-yl]acetamide;but-2-enedioic acid (PubChem CID 67712356) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-amino-N-[2-(4-hydroxyphenyl)-1-phenylpropan-2-yl]acetamide;but-2-enedioic acid.
| Compound Name | 2-amino-N-[2-(4-hydroxyphenyl)-1-phenylpropan-2-yl]acetamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 67712356 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-amino-N-[2-(4-hydroxyphenyl)-1-phenylpropan-2-yl]acetamide;but-2-enedioic acid |
| SMILES | CC(Cc1ccccc1)(NC(=O)CN)c1ccc(O)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H20N2O2.C4H4O4/c1-17(19-16(21)12-18,11-13-5-3-2-4-6-13)14-7-9-15(20)10-8-14;5-3(6)1-2-4(7)8/h2-10,20H,11-12,18H2,1H3,(H,19,21);1-2H,(H,5,6)(H,7,8) |
| InChIKey | PHVHUIIZPDHZDK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|