C22H23N3O5 — CID 67712194
2-amino-N-[1-(3-cyanophenyl)-2-phenylpropan-2-yl]acetamide;but-2-enedioic acid (PubChem CID 67712194) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-amino-N-[1-(3-cyanophenyl)-2-phenylpropan-2-yl]acetamide;but-2-enedioic acid.
| Compound Name | 2-amino-N-[1-(3-cyanophenyl)-2-phenylpropan-2-yl]acetamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 67712194 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-amino-N-[1-(3-cyanophenyl)-2-phenylpropan-2-yl]acetamide;but-2-enedioic acid |
| SMILES | CC(Cc1cccc(C#N)c1)(NC(=O)CN)c1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H19N3O.C4H4O4/c1-18(21-17(22)13-20,16-8-3-2-4-9-16)11-14-6-5-7-15(10-14)12-19;5-3(6)1-2-4(7)8/h2-10H,11,13,20H2,1H3,(H,21,22);1-2H,(H,5,6)(H,7,8) |
| InChIKey | SVRUIPLGBCCVNG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 153.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|