C19H24N2O4S — CID 54415664
3-amino-N-benzyl-3-(4-methoxyphenyl)sulfonyl-2,2-dimethylpropanamide (PubChem CID 54415664) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-amino-N-benzyl-3-(4-methoxyphenyl)sulfonyl-2,2-dimethylpropanamide.
| Compound Name | 3-amino-N-benzyl-3-(4-methoxyphenyl)sulfonyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 54415664 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-amino-N-benzyl-3-(4-methoxyphenyl)sulfonyl-2,2-dimethylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)C(N)C(C)(C)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-19(2,18(22)21-13-14-7-5-4-6-8-14)17(20)26(23,24)16-11-9-15(25-3)10-12-16/h4-12,17H,13,20H2,1-3H3,(H,21,22) |
| InChIKey | VXFNVEWSMPMPGP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |