C26H35NO6S — CID 70062115
ethyl 2-(4-methoxyphenyl)sulfonyl-2-methyl-3-[4-(2-piperidin-2-ylethoxy)phenyl]propanoate (PubChem CID 70062115) has the molecular formula C26H35NO6S and a molecular weight of 489.63 g/mol. Its IUPAC name is ethyl 2-(4-methoxyphenyl)sulfonyl-2-methyl-3-[4-(2-piperidin-2-ylethoxy)phenyl]propanoate.
| Compound Name | ethyl 2-(4-methoxyphenyl)sulfonyl-2-methyl-3-[4-(2-piperidin-2-ylethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 70062115 |
| Molecular Formula | C26H35NO6S |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)sulfonyl-2-methyl-3-[4-(2-piperidin-2-ylethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccc(OCCC2CCCCN2)cc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H35NO6S/c1-4-32-25(28)26(2,34(29,30)24-14-12-22(31-3)13-15-24)19-20-8-10-23(11-9-20)33-18-16-21-7-5-6-17-27-21/h8-15,21,27H,4-7,16-19H2,1-3H3 |
| InChIKey | XBKCZDUTYRQSGO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |