C22H26O4S — CID 54271832
ethyl 2-benzyl-2-[(4-methoxyphenyl)methylsulfanylmethyl]-4-oxobutanoate (PubChem CID 54271832) has the molecular formula C22H26O4S and a molecular weight of 386.51 g/mol. Its IUPAC name is ethyl 2-benzyl-2-[(4-methoxyphenyl)methylsulfanylmethyl]-4-oxobutanoate.
| Compound Name | ethyl 2-benzyl-2-[(4-methoxyphenyl)methylsulfanylmethyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 54271832 |
| Molecular Formula | C22H26O4S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | ethyl 2-benzyl-2-[(4-methoxyphenyl)methylsulfanylmethyl]-4-oxobutanoate |
| SMILES | CCOC(=O)C(CC=O)(CSCc1ccc(OC)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H26O4S/c1-3-26-21(24)22(13-14-23,15-18-7-5-4-6-8-18)17-27-16-19-9-11-20(25-2)12-10-19/h4-12,14H,3,13,15-17H2,1-2H3 |
| InChIKey | RKRRXVWHEGILEO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|