C25H25NO3S — CID 56625272
N-[(2S)-2-[(4-methoxyphenyl)methylsulfanyl]-4-oxo-1-phenylbutan-2-yl]benzamide (PubChem CID 56625272) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[(2S)-2-[(4-methoxyphenyl)methylsulfanyl]-4-oxo-1-phenylbutan-2-yl]benzamide.
| Compound Name | N-[(2S)-2-[(4-methoxyphenyl)methylsulfanyl]-4-oxo-1-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 56625272 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[(2S)-2-[(4-methoxyphenyl)methylsulfanyl]-4-oxo-1-phenylbutan-2-yl]benzamide |
| SMILES | COc1ccc(CS[C@](CC=O)(Cc2ccccc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-29-23-14-12-21(13-15-23)19-30-25(16-17-27,18-20-8-4-2-5-9-20)26-24(28)22-10-6-3-7-11-22/h2-15,17H,16,18-19H2,1H3,(H,26,28)/t25-/m1/s1 |
| InChIKey | WMBYJSNBNCYNFC-RUZDIDTESA-N |
| XLogP | 4.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|