C27H28FNO3 — CID 134949704
methyl (E,2S)-2-(N-ethyl-4-methoxyanilino)-2-(4-fluorophenyl)-5-phenylpent-4-enoate (PubChem CID 134949704) has the molecular formula C27H28FNO3 and a molecular weight of 433.52 g/mol. Its IUPAC name is methyl (E,2S)-2-(N-ethyl-4-methoxyanilino)-2-(4-fluorophenyl)-5-phenylpent-4-enoate.
| Compound Name | methyl (E,2S)-2-(N-ethyl-4-methoxyanilino)-2-(4-fluorophenyl)-5-phenylpent-4-enoate |
|---|---|
| PubChem CID | 134949704 |
| Molecular Formula | C27H28FNO3 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | methyl (E,2S)-2-(N-ethyl-4-methoxyanilino)-2-(4-fluorophenyl)-5-phenylpent-4-enoate |
| SMILES | CCN(c1ccc(OC)cc1)[C@](C/C=C/c1ccccc1)(C(=O)OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FNO3/c1-4-29(24-16-18-25(31-2)19-17-24)27(26(30)32-3,22-12-14-23(28)15-13-22)20-8-11-21-9-6-5-7-10-21/h5-19H,4,20H2,1-3H3/b11-8+/t27-/m0/s1 |
| InChIKey | OLPQTCFZHJFBPG-HSDHKRTLSA-N |
| XLogP | 5.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|