C24H31NO5 — CID 101473255
1-O-ethyl 4-O-methyl 2-(N-ethyl-4-methoxyanilino)-3,3-dimethyl-2-phenylbutanedioate (PubChem CID 101473255) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl 2-(N-ethyl-4-methoxyanilino)-3,3-dimethyl-2-phenylbutanedioate.
| Compound Name | 1-O-ethyl 4-O-methyl 2-(N-ethyl-4-methoxyanilino)-3,3-dimethyl-2-phenylbutanedioate |
|---|---|
| PubChem CID | 101473255 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-O-ethyl 4-O-methyl 2-(N-ethyl-4-methoxyanilino)-3,3-dimethyl-2-phenylbutanedioate |
| SMILES | CCOC(=O)C(c1ccccc1)(N(CC)c1ccc(OC)cc1)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C24H31NO5/c1-7-25(19-14-16-20(28-5)17-15-19)24(22(27)30-8-2,18-12-10-9-11-13-18)23(3,4)21(26)29-6/h9-17H,7-8H2,1-6H3 |
| InChIKey | AXIIWSNAUPWGNR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|