C24H31NO — CID 150436491
N-(cyclopropylmethyl)-3-(4-methoxyphenyl)-N-methyl-6-phenylhex-5-en-3-amine (PubChem CID 150436491) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-(4-methoxyphenyl)-N-methyl-6-phenylhex-5-en-3-amine.
| Compound Name | N-(cyclopropylmethyl)-3-(4-methoxyphenyl)-N-methyl-6-phenylhex-5-en-3-amine |
|---|---|
| PubChem CID | 150436491 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-(cyclopropylmethyl)-3-(4-methoxyphenyl)-N-methyl-6-phenylhex-5-en-3-amine |
| SMILES | CCC(CC=Cc1ccccc1)(c1ccc(OC)cc1)N(C)CC1CC1 |
| InChI | InChI=1S/C24H31NO/c1-4-24(25(2)19-21-12-13-21,22-14-16-23(26-3)17-15-22)18-8-11-20-9-6-5-7-10-20/h5-11,14-17,21H,4,12-13,18-19H2,1-3H3 |
| InChIKey | HKWJYANVCMFSJC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |