C18H17F3N2O — CID 139257687
3,3,3-trifluoro-2-(4-methoxyanilino)-2-[(3-methylphenyl)methyl]propanenitrile (PubChem CID 139257687) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(4-methoxyanilino)-2-[(3-methylphenyl)methyl]propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-(4-methoxyanilino)-2-[(3-methylphenyl)methyl]propanenitrile |
|---|---|
| PubChem CID | 139257687 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3,3,3-trifluoro-2-(4-methoxyanilino)-2-[(3-methylphenyl)methyl]propanenitrile |
| SMILES | COc1ccc(NC(C#N)(Cc2cccc(C)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N2O/c1-13-4-3-5-14(10-13)11-17(12-22,18(19,20)21)23-15-6-8-16(24-2)9-7-15/h3-10,23H,11H2,1-2H3 |
| InChIKey | JULMEIUJVCHVGK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|