C9H2F13O2- — CID 154405033
3,4,4,5,5,6,6,7,7,7-decafluoro-2-methylidene-3-(trifluoromethyl)heptanoate (PubChem CID 154405033) has the molecular formula C9H2F13O2- and a molecular weight of 389.09 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,7,7,7-decafluoro-2-methylidene-3-(trifluoromethyl)heptanoate.
| Compound Name | 3,4,4,5,5,6,6,7,7,7-decafluoro-2-methylidene-3-(trifluoromethyl)heptanoate |
|---|---|
| PubChem CID | 154405033 |
| Molecular Formula | C9H2F13O2- |
| Molecular Weight | 389.09 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 3,4,4,5,5,6,6,7,7,7-decafluoro-2-methylidene-3-(trifluoromethyl)heptanoate |
| SMILES | C=C(C(=O)[O-])C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H3F13O2/c1-2(3(23)24)4(10,8(17,18)19)5(11,12)6(13,14)7(15,16)9(20,21)22/h1H2,(H,23,24)/p-1 |
| InChIKey | YJFKEIOPIAUBFM-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.09 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|