C48H70N4O16S8 — CID 101106553
N,N'-dibenzyl-N'-[6-[benzyl-[6-[benzyl(methylsulfonyl)sulfamoyl]hexylsulfonyl]sulfamoyl]hexylsulfonyl]-N-methylsulfonylhexane-1,6-disulfonamide (PubChem CID 101106553) has the molecular formula C48H70N4O16S8 and a molecular weight of 1215.64 g/mol. Its IUPAC name is N,N'-dibenzyl-N'-[6-[benzyl-[6-[benzyl(methylsulfonyl)sulfamoyl]hexylsulfonyl]sulfamoyl]hexylsulfonyl]-N-methylsulfonylhexane-1,6-disulfonamide.
| Compound Name | N,N'-dibenzyl-N'-[6-[benzyl-[6-[benzyl(methylsulfonyl)sulfamoyl]hexylsulfonyl]sulfamoyl]hexylsulfonyl]-N-methylsulfonylhexane-1,6-disulfonamide |
|---|---|
| PubChem CID | 101106553 |
| Molecular Formula | C48H70N4O16S8 |
| Molecular Weight | 1215.64 g/mol |
| Exact Mass | 1214.26 |
| IUPAC Name | N,N'-dibenzyl-N'-[6-[benzyl-[6-[benzyl(methylsulfonyl)sulfamoyl]hexylsulfonyl]sulfamoyl]hexylsulfonyl]-N-methylsulfonylhexane-1,6-disulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1)S(=O)(=O)CCCCCCS(=O)(=O)N(Cc1ccccc1)S(=O)(=O)CCCCCCS(=O)(=O)N(Cc1ccccc1)S(=O)(=O)CCCCCCS(=O)(=O)N(Cc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C48H70N4O16S8/c1-69(53,54)49(41-45-27-13-9-14-28-45)71(57,58)35-21-3-5-23-37-73(61,62)51(43-47-31-17-11-18-32-47)75(65,66)39-25-7-8-26-40-76(67,68)52(44-48-33-19-12-20-34-48)74(63,64)38-24-6-4-22-36-72(59,60)50(70(2,55)56)42-46-29-15-10-16-30-46/h9-20,27-34H,3-8,21-26,35-44H2,1-2H3 |
| InChIKey | NEJZUSHAYWTQQU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 286.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1215.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|