C15H25NO2S — CID 110669404
N-(2,2-dimethylpropyl)-N-methyl-3-phenylpropane-1-sulfonamide (PubChem CID 110669404) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N-methyl-3-phenylpropane-1-sulfonamide.
| Compound Name | N-(2,2-dimethylpropyl)-N-methyl-3-phenylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 110669404 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N-methyl-3-phenylpropane-1-sulfonamide |
| SMILES | CN(CC(C)(C)C)S(=O)(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C15H25NO2S/c1-15(2,3)13-16(4)19(17,18)12-8-11-14-9-6-5-7-10-14/h5-7,9-10H,8,11-13H2,1-4H3 |
| InChIKey | QYOMYEILROLVTG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |