C16H20N2O2S — CID 110724741
N-methyl-3-phenyl-N-(pyridin-3-ylmethyl)propane-1-sulfonamide (PubChem CID 110724741) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-methyl-3-phenyl-N-(pyridin-3-ylmethyl)propane-1-sulfonamide.
| Compound Name | N-methyl-3-phenyl-N-(pyridin-3-ylmethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 110724741 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-methyl-3-phenyl-N-(pyridin-3-ylmethyl)propane-1-sulfonamide |
| SMILES | CN(Cc1cccnc1)S(=O)(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C16H20N2O2S/c1-18(14-16-9-5-11-17-13-16)21(19,20)12-6-10-15-7-3-2-4-8-15/h2-5,7-9,11,13H,6,10,12,14H2,1H3 |
| InChIKey | PYUKMUZGSVFAEY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |