C21H22N2O2S — CID 110360388
N-(3-methylphenyl)-2-phenyl-N-(pyridin-3-ylmethyl)ethanesulfonamide (PubChem CID 110360388) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-phenyl-N-(pyridin-3-ylmethyl)ethanesulfonamide.
| Compound Name | N-(3-methylphenyl)-2-phenyl-N-(pyridin-3-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110360388 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-(3-methylphenyl)-2-phenyl-N-(pyridin-3-ylmethyl)ethanesulfonamide |
| SMILES | Cc1cccc(N(Cc2cccnc2)S(=O)(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C21H22N2O2S/c1-18-7-5-11-21(15-18)23(17-20-10-6-13-22-16-20)26(24,25)14-12-19-8-3-2-4-9-19/h2-11,13,15-16H,12,14,17H2,1H3 |
| InChIKey | KIUJMOZMHQOUEL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |