C22H26N2O3S — CID 91055403
ethane;N-(3-phenoxyphenyl)-N-(pyridin-3-ylmethyl)ethanesulfonamide (PubChem CID 91055403) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is ethane;N-(3-phenoxyphenyl)-N-(pyridin-3-ylmethyl)ethanesulfonamide.
| Compound Name | ethane;N-(3-phenoxyphenyl)-N-(pyridin-3-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 91055403 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | ethane;N-(3-phenoxyphenyl)-N-(pyridin-3-ylmethyl)ethanesulfonamide |
| SMILES | CC.CCS(=O)(=O)N(Cc1cccnc1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H20N2O3S.C2H6/c1-2-26(23,24)22(16-17-8-7-13-21-15-17)18-9-6-12-20(14-18)25-19-10-4-3-5-11-19;1-2/h3-15H,2,16H2,1H3;1-2H3 |
| InChIKey | PEZUXDRLLDTXHE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |