C22H24N2O3S — CID 23521704
N-[3-[hydroxy-(4-methylphenyl)methyl]phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide (PubChem CID 23521704) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-[3-[hydroxy-(4-methylphenyl)methyl]phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide.
| Compound Name | N-[3-[hydroxy-(4-methylphenyl)methyl]phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 23521704 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[3-[hydroxy-(4-methylphenyl)methyl]phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(Cc1cccnc1)c1cccc(C(O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H24N2O3S/c1-3-28(26,27)24(16-18-6-5-13-23-15-18)21-8-4-7-20(14-21)22(25)19-11-9-17(2)10-12-19/h4-15,22,25H,3,16H2,1-2H3 |
| InChIKey | ZBOJOVQLNIUIQY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |