C19H17ClN2O3S — CID 110360581
2-chloro-N-(3-methoxyphenyl)-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 110360581) has the molecular formula C19H17ClN2O3S and a molecular weight of 388.88 g/mol. Its IUPAC name is 2-chloro-N-(3-methoxyphenyl)-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(3-methoxyphenyl)-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110360581 |
| Molecular Formula | C19H17ClN2O3S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-chloro-N-(3-methoxyphenyl)-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | COc1cccc(N(Cc2cccnc2)S(=O)(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O3S/c1-25-17-8-4-7-16(12-17)22(14-15-6-5-11-21-13-15)26(23,24)19-10-3-2-9-18(19)20/h2-13H,14H2,1H3 |
| InChIKey | MTXSNRHORAUCFJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |