C14H23NO2S — CID 110669403
N-(2,2-dimethylpropyl)-N-methyl-2-phenylethanesulfonamide (PubChem CID 110669403) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N-methyl-2-phenylethanesulfonamide.
| Compound Name | N-(2,2-dimethylpropyl)-N-methyl-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 110669403 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N-methyl-2-phenylethanesulfonamide |
| SMILES | CN(CC(C)(C)C)S(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H23NO2S/c1-14(2,3)12-15(4)18(16,17)11-10-13-8-6-5-7-9-13/h5-9H,10-12H2,1-4H3 |
| InChIKey | YSOLSHNTBZGJPD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |