C10H14BrNO2S — CID 175834511
2-(4-bromophenyl)-N,N-dimethylethanesulfonamide (PubChem CID 175834511) has the molecular formula C10H14BrNO2S and a molecular weight of 292.20 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N,N-dimethylethanesulfonamide.
| Compound Name | 2-(4-bromophenyl)-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 175834511 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-(4-bromophenyl)-N,N-dimethylethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H14BrNO2S/c1-12(2)15(13,14)8-7-9-3-5-10(11)6-4-9/h3-6H,7-8H2,1-2H3 |
| InChIKey | BMMFSJUDSMJPIF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |