C11H14BrN3O2S — CID 106338562
2-(4-bromo-2-cyanoanilino)-N,N-dimethylethanesulfonamide (PubChem CID 106338562) has the molecular formula C11H14BrN3O2S and a molecular weight of 332.22 g/mol. Its IUPAC name is 2-(4-bromo-2-cyanoanilino)-N,N-dimethylethanesulfonamide.
| Compound Name | 2-(4-bromo-2-cyanoanilino)-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106338562 |
| Molecular Formula | C11H14BrN3O2S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2-(4-bromo-2-cyanoanilino)-N,N-dimethylethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNc1ccc(Br)cc1C#N |
| InChI | InChI=1S/C11H14BrN3O2S/c1-15(2)18(16,17)6-5-14-11-4-3-10(12)7-9(11)8-13/h3-4,7,14H,5-6H2,1-2H3 |
| InChIKey | KGJNSACIDCBSOZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |