C12H17N3O2S — CID 106338578
2-(2-cyano-5-methylanilino)-N,N-dimethylethanesulfonamide (PubChem CID 106338578) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-(2-cyano-5-methylanilino)-N,N-dimethylethanesulfonamide.
| Compound Name | 2-(2-cyano-5-methylanilino)-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106338578 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(2-cyano-5-methylanilino)-N,N-dimethylethanesulfonamide |
| SMILES | Cc1ccc(C#N)c(NCCS(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C12H17N3O2S/c1-10-4-5-11(9-13)12(8-10)14-6-7-18(16,17)15(2)3/h4-5,8,14H,6-7H2,1-3H3 |
| InChIKey | MEGWTIFXYZSQPA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |