C18H29NO6S — CID 70661427
3-(methoxymethoxy)-N-[(1R)-1-[3-(oxan-4-yloxy)phenyl]ethyl]propane-1-sulfonamide (PubChem CID 70661427) has the molecular formula C18H29NO6S and a molecular weight of 387.50 g/mol. Its IUPAC name is 3-(methoxymethoxy)-N-[(1R)-1-[3-(oxan-4-yloxy)phenyl]ethyl]propane-1-sulfonamide.
| Compound Name | 3-(methoxymethoxy)-N-[(1R)-1-[3-(oxan-4-yloxy)phenyl]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 70661427 |
| Molecular Formula | C18H29NO6S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-(methoxymethoxy)-N-[(1R)-1-[3-(oxan-4-yloxy)phenyl]ethyl]propane-1-sulfonamide |
| SMILES | COCOCCCS(=O)(=O)N[C@H](C)c1cccc(OC2CCOCC2)c1 |
| InChI | InChI=1S/C18H29NO6S/c1-15(19-26(20,21)12-4-9-24-14-22-2)16-5-3-6-18(13-16)25-17-7-10-23-11-8-17/h3,5-6,13,15,17,19H,4,7-12,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | UNXPISPYMONHBC-OAHLLOKOSA-N |
| XLogP | 2.24 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|