C22H37NO3S — CID 146353248
N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-6,6-dimethylheptane-1-sulfonamide (PubChem CID 146353248) has the molecular formula C22H37NO3S and a molecular weight of 395.61 g/mol. Its IUPAC name is N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-6,6-dimethylheptane-1-sulfonamide.
| Compound Name | N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-6,6-dimethylheptane-1-sulfonamide |
|---|---|
| PubChem CID | 146353248 |
| Molecular Formula | C22H37NO3S |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-6,6-dimethylheptane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCCCC(C)(C)C)c1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C22H37NO3S/c1-18(23-27(24,25)16-9-5-8-15-22(2,3)4)19-11-10-14-21(17-19)26-20-12-6-7-13-20/h10-11,14,17-18,20,23H,5-9,12-13,15-16H2,1-4H3/t18-/m1/s1 |
| InChIKey | UVSTXXGFKBDBHZ-GOSISDBHSA-N |
| XLogP | 5.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|