C22H30FN3O5S — CID 53233948
N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)pentane-1-sulfonamide (PubChem CID 53233948) has the molecular formula C22H30FN3O5S and a molecular weight of 467.56 g/mol. Its IUPAC name is N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 53233948 |
| Molecular Formula | C22H30FN3O5S |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)pentane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCCCn1cc(F)c(=O)[nH]c1=O)c1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C22H30FN3O5S/c1-16(17-8-7-11-19(14-17)31-18-9-3-4-10-18)25-32(29,30)13-6-2-5-12-26-15-20(23)21(27)24-22(26)28/h7-8,11,14-16,18,25H,2-6,9-10,12-13H2,1H3,(H,24,27,28)/t16-/m1/s1 |
| InChIKey | RXVXQHUUXPTXAP-MRXNPFEDSA-N |
| XLogP | 2.85 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|