C18H29NO5S — CID 70661422
N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-3-(methoxymethoxy)propane-1-sulfonamide (PubChem CID 70661422) has the molecular formula C18H29NO5S and a molecular weight of 371.50 g/mol. Its IUPAC name is N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-3-(methoxymethoxy)propane-1-sulfonamide.
| Compound Name | N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-3-(methoxymethoxy)propane-1-sulfonamide |
|---|---|
| PubChem CID | 70661422 |
| Molecular Formula | C18H29NO5S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]-3-(methoxymethoxy)propane-1-sulfonamide |
| SMILES | COCOCCCS(=O)(=O)N[C@H](C)c1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C18H29NO5S/c1-15(19-25(20,21)12-6-11-23-14-22-2)16-7-5-10-18(13-16)24-17-8-3-4-9-17/h5,7,10,13,15,17,19H,3-4,6,8-9,11-12,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | XCLNMPFPUFBWAP-OAHLLOKOSA-N |
| XLogP | 3.00 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|