C18H27NO5S — CID 139451649
3-[[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]sulfamoyl]propyl acetate (PubChem CID 139451649) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is 3-[[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]sulfamoyl]propyl acetate.
| Compound Name | 3-[[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]sulfamoyl]propyl acetate |
|---|---|
| PubChem CID | 139451649 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-[[(1R)-1-(3-cyclopentyloxyphenyl)ethyl]sulfamoyl]propyl acetate |
| SMILES | CC(=O)OCCCS(=O)(=O)N[C@H](C)c1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C18H27NO5S/c1-14(19-25(21,22)12-6-11-23-15(2)20)16-7-5-10-18(13-16)24-17-8-3-4-9-17/h5,7,10,13-14,17,19H,3-4,6,8-9,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | ZXQIEZFEQMFBAV-CQSZACIVSA-N |
| XLogP | 2.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|