C12H16ClF4NO — CID 171208533
(1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-amine;hydrochloride (PubChem CID 171208533) has the molecular formula C12H16ClF4NO and a molecular weight of 301.71 g/mol. Its IUPAC name is (1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-amine;hydrochloride.
| Compound Name | (1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171208533 |
| Molecular Formula | C12H16ClF4NO |
| Molecular Weight | 301.71 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (1R)-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-amine;hydrochloride |
| SMILES | CCC[C@@H](N)c1ccccc1OC(F)(F)C(F)F.Cl |
| InChI | InChI=1S/C12H15F4NO.ClH/c1-2-5-9(17)8-6-3-4-7-10(8)18-12(15,16)11(13)14;/h3-4,6-7,9,11H,2,5,17H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | JQZAQLZYIRJIQH-SBSPUUFOSA-N |
| XLogP | 4.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|