C12H18ClF2NO — CID 171211366
(1R)-1-[2-(difluoromethoxy)phenyl]pentan-1-amine;hydrochloride (PubChem CID 171211366) has the molecular formula C12H18ClF2NO and a molecular weight of 265.73 g/mol. Its IUPAC name is (1R)-1-[2-(difluoromethoxy)phenyl]pentan-1-amine;hydrochloride.
| Compound Name | (1R)-1-[2-(difluoromethoxy)phenyl]pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171211366 |
| Molecular Formula | C12H18ClF2NO |
| Molecular Weight | 265.73 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (1R)-1-[2-(difluoromethoxy)phenyl]pentan-1-amine;hydrochloride |
| SMILES | CCCC[C@@H](N)c1ccccc1OC(F)F.Cl |
| InChI | InChI=1S/C12H17F2NO.ClH/c1-2-3-7-10(15)9-6-4-5-8-11(9)16-12(13)14;/h4-6,8,10,12H,2-3,7,15H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | MOGXTADQLIODCC-HNCPQSOCSA-N |
| XLogP | 3.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |