C18H24ClNO — CID 171214274
(1R)-1-(2-phenylmethoxyphenyl)pentan-1-amine;hydrochloride (PubChem CID 171214274) has the molecular formula C18H24ClNO and a molecular weight of 305.85 g/mol. Its IUPAC name is (1R)-1-(2-phenylmethoxyphenyl)pentan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2-phenylmethoxyphenyl)pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171214274 |
| Molecular Formula | C18H24ClNO |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (1R)-1-(2-phenylmethoxyphenyl)pentan-1-amine;hydrochloride |
| SMILES | CCCC[C@@H](N)c1ccccc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C18H23NO.ClH/c1-2-3-12-17(19)16-11-7-8-13-18(16)20-14-15-9-5-4-6-10-15;/h4-11,13,17H,2-3,12,14,19H2,1H3;1H/t17-;/m1./s1 |
| InChIKey | XIVKOHFRVLSAHQ-UNTBIKODSA-N |
| XLogP | 4.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |