C15H22ClF4NO2 — CID 171263629
(1R,2S)-1-amino-5-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]hexan-2-ol;hydrochloride (PubChem CID 171263629) has the molecular formula C15H22ClF4NO2 and a molecular weight of 359.79 g/mol. Its IUPAC name is (1R,2S)-1-amino-5-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]hexan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-5-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]hexan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171263629 |
| Molecular Formula | C15H22ClF4NO2 |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (1R,2S)-1-amino-5-methyl-1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]hexan-2-ol;hydrochloride |
| SMILES | CC(C)CC[C@H](O)[C@H](N)c1ccccc1OC(F)(F)C(F)F.Cl |
| InChI | InChI=1S/C15H21F4NO2.ClH/c1-9(2)7-8-11(21)13(20)10-5-3-4-6-12(10)22-15(18,19)14(16)17;/h3-6,9,11,13-14,21H,7-8,20H2,1-2H3;1H/t11-,13+;/m0./s1 |
| InChIKey | DWPRMPMCFDRIEZ-STEACBGWSA-N |
| XLogP | 4.14 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|