C13H15NO4 — CID 71762478
5-[(3R,4R)-4-nitrohex-1-en-3-yl]-1,3-benzodioxole (PubChem CID 71762478) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-[(3R,4R)-4-nitrohex-1-en-3-yl]-1,3-benzodioxole.
| Compound Name | 5-[(3R,4R)-4-nitrohex-1-en-3-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 71762478 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5-[(3R,4R)-4-nitrohex-1-en-3-yl]-1,3-benzodioxole |
| SMILES | C=C[C@H](c1ccc2c(c1)OCO2)[C@@H](CC)[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO4/c1-3-10(11(4-2)14(15)16)9-5-6-12-13(7-9)18-8-17-12/h3,5-7,10-11H,1,4,8H2,2H3/t10-,11-/m1/s1 |
| InChIKey | OMPTWQUOVQJQIM-GHMZBOCLSA-N |
| XLogP | 2.74 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|