C13H17NO2 — CID 71762240
[(3R,4R)-4-nitrohept-1-en-3-yl]benzene (PubChem CID 71762240) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is [(3R,4R)-4-nitrohept-1-en-3-yl]benzene.
| Compound Name | [(3R,4R)-4-nitrohept-1-en-3-yl]benzene |
|---|---|
| PubChem CID | 71762240 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | [(3R,4R)-4-nitrohept-1-en-3-yl]benzene |
| SMILES | C=C[C@H](c1ccccc1)[C@@H](CCC)[N+](=O)[O-] |
| InChI | InChI=1S/C13H17NO2/c1-3-8-13(14(15)16)12(4-2)11-9-6-5-7-10-11/h4-7,9-10,12-13H,2-3,8H2,1H3/t12-,13-/m1/s1 |
| InChIKey | OVTZZBIIXWZLKT-CHWSQXEVSA-N |
| XLogP | 3.40 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|