C10H9F3O2S — CID 125475568
5-[(1S)-1-(trifluoromethylsulfanyl)ethyl]-1,3-benzodioxole (PubChem CID 125475568) has the molecular formula C10H9F3O2S and a molecular weight of 250.24 g/mol. Its IUPAC name is 5-[(1S)-1-(trifluoromethylsulfanyl)ethyl]-1,3-benzodioxole.
| Compound Name | 5-[(1S)-1-(trifluoromethylsulfanyl)ethyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 125475568 |
| Molecular Formula | C10H9F3O2S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5-[(1S)-1-(trifluoromethylsulfanyl)ethyl]-1,3-benzodioxole |
| SMILES | C[C@H](SC(F)(F)F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H9F3O2S/c1-6(16-10(11,12)13)7-2-3-8-9(4-7)15-5-14-8/h2-4,6H,5H2,1H3/t6-/m0/s1 |
| InChIKey | VSTSNXHQYYUPIT-LURJTMIESA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |