C17H15Cl3O — CID 107294266
5-[chloro-(2,5-dichlorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran (PubChem CID 107294266) has the molecular formula C17H15Cl3O and a molecular weight of 341.67 g/mol. Its IUPAC name is 5-[chloro-(2,5-dichlorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran.
| Compound Name | 5-[chloro-(2,5-dichlorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran |
|---|---|
| PubChem CID | 107294266 |
| Molecular Formula | C17H15Cl3O |
| Molecular Weight | 341.67 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 5-[chloro-(2,5-dichlorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran |
| SMILES | CC1(C)COc2ccc(C(Cl)c3cc(Cl)ccc3Cl)cc21 |
| InChI | InChI=1S/C17H15Cl3O/c1-17(2)9-21-15-6-3-10(7-13(15)17)16(20)12-8-11(18)4-5-14(12)19/h3-8,16H,9H2,1-2H3 |
| InChIKey | PCXMYASKHGGETC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|