C17H15Br2ClO — CID 107294499
5-[bromo-(4-bromo-2-chlorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran (PubChem CID 107294499) has the molecular formula C17H15Br2ClO and a molecular weight of 430.57 g/mol. Its IUPAC name is 5-[bromo-(4-bromo-2-chlorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran.
| Compound Name | 5-[bromo-(4-bromo-2-chlorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran |
|---|---|
| PubChem CID | 107294499 |
| Molecular Formula | C17H15Br2ClO |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 427.92 |
| IUPAC Name | 5-[bromo-(4-bromo-2-chlorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran |
| SMILES | CC1(C)COc2ccc(C(Br)c3ccc(Br)cc3Cl)cc21 |
| InChI | InChI=1S/C17H15Br2ClO/c1-17(2)9-21-15-6-3-10(7-13(15)17)16(19)12-5-4-11(18)8-14(12)20/h3-8,16H,9H2,1-2H3 |
| InChIKey | FQOYKFHYBVHTMY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|