C17H15BrCl2O — CID 107959246
5-[(3-bromo-5-chlorophenyl)-chloromethyl]-3,3-dimethyl-2H-1-benzofuran (PubChem CID 107959246) has the molecular formula C17H15BrCl2O and a molecular weight of 386.12 g/mol. Its IUPAC name is 5-[(3-bromo-5-chlorophenyl)-chloromethyl]-3,3-dimethyl-2H-1-benzofuran.
| Compound Name | 5-[(3-bromo-5-chlorophenyl)-chloromethyl]-3,3-dimethyl-2H-1-benzofuran |
|---|---|
| PubChem CID | 107959246 |
| Molecular Formula | C17H15BrCl2O |
| Molecular Weight | 386.12 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | 5-[(3-bromo-5-chlorophenyl)-chloromethyl]-3,3-dimethyl-2H-1-benzofuran |
| SMILES | CC1(C)COc2ccc(C(Cl)c3cc(Cl)cc(Br)c3)cc21 |
| InChI | InChI=1S/C17H15BrCl2O/c1-17(2)9-21-15-4-3-10(7-14(15)17)16(20)11-5-12(18)8-13(19)6-11/h3-8,16H,9H2,1-2H3 |
| InChIKey | RSYBSPAVTLPWHA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.12 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|