C17H15Cl2FO — CID 107992313
5-[chloro-(4-chloro-3-fluorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran (PubChem CID 107992313) has the molecular formula C17H15Cl2FO and a molecular weight of 325.21 g/mol. Its IUPAC name is 5-[chloro-(4-chloro-3-fluorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran.
| Compound Name | 5-[chloro-(4-chloro-3-fluorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran |
|---|---|
| PubChem CID | 107992313 |
| Molecular Formula | C17H15Cl2FO |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 5-[chloro-(4-chloro-3-fluorophenyl)methyl]-3,3-dimethyl-2H-1-benzofuran |
| SMILES | CC1(C)COc2ccc(C(Cl)c3ccc(Cl)c(F)c3)cc21 |
| InChI | InChI=1S/C17H15Cl2FO/c1-17(2)9-21-15-6-4-10(7-12(15)17)16(19)11-3-5-13(18)14(20)8-11/h3-8,16H,9H2,1-2H3 |
| InChIKey | DEBSVOXTNZMLKZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|