C19H28O2 — CID 107294159
2-cycloheptyl-1-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethanol (PubChem CID 107294159) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-cycloheptyl-1-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethanol.
| Compound Name | 2-cycloheptyl-1-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethanol |
|---|---|
| PubChem CID | 107294159 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-cycloheptyl-1-(3,3-dimethyl-2H-1-benzofuran-5-yl)ethanol |
| SMILES | CC1(C)COc2ccc(C(O)CC3CCCCCC3)cc21 |
| InChI | InChI=1S/C19H28O2/c1-19(2)13-21-18-10-9-15(12-16(18)19)17(20)11-14-7-5-3-4-6-8-14/h9-10,12,14,17,20H,3-8,11,13H2,1-2H3 |
| InChIKey | AIARYTGZFGIENK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |