C18H26O3 — CID 107294030
1-(3,3-dimethyl-2H-1-benzofuran-5-yl)-3-(oxan-2-yl)propan-1-ol (PubChem CID 107294030) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2H-1-benzofuran-5-yl)-3-(oxan-2-yl)propan-1-ol.
| Compound Name | 1-(3,3-dimethyl-2H-1-benzofuran-5-yl)-3-(oxan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 107294030 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-(3,3-dimethyl-2H-1-benzofuran-5-yl)-3-(oxan-2-yl)propan-1-ol |
| SMILES | CC1(C)COc2ccc(C(O)CCC3CCCCO3)cc21 |
| InChI | InChI=1S/C18H26O3/c1-18(2)12-21-17-9-6-13(11-15(17)18)16(19)8-7-14-5-3-4-10-20-14/h6,9,11,14,16,19H,3-5,7-8,10,12H2,1-2H3 |
| InChIKey | NOAATQRDNRBPBR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |