C15H21BrO3S — CID 104521504
2-[bromo-(4-propan-2-yloxyphenyl)methyl]thiane 1,1-dioxide (PubChem CID 104521504) has the molecular formula C15H21BrO3S and a molecular weight of 361.30 g/mol. Its IUPAC name is 2-[bromo-(4-propan-2-yloxyphenyl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[bromo-(4-propan-2-yloxyphenyl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104521504 |
| Molecular Formula | C15H21BrO3S |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-[bromo-(4-propan-2-yloxyphenyl)methyl]thiane 1,1-dioxide |
| SMILES | CC(C)Oc1ccc(C(Br)C2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C15H21BrO3S/c1-11(2)19-13-8-6-12(7-9-13)15(16)14-5-3-4-10-20(14,17)18/h6-9,11,14-15H,3-5,10H2,1-2H3 |
| InChIKey | SRYYNOVUHINFDN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|